cas: 1820583-83-2 — see every product listed under this CAS number, including other names
(2S,4S)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-4-carboxylic acid, 98% (CAS 1820583-83-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 50mg. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A599679-5g |
| cas | 1820583-83-2 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 26650.33 Pln | |
| Fluorochem | 100mg | 1148.57 Pln | |
| Fluorochem | 250mg | 1799.38 Pln | |
| Fluorochem | 500mg | 3335.30 Pln | |
| Fluorochem | 1g | 4387.01 Pln | |
| Fluorochem | 5g | 16773.28 Pln | |
| Chemat | 50mg | 621.20 Pln | |
| Chemat | 100mg | 846.80 Pln | |
| Chemat | 250mg | 1312.40 Pln | |
| Chemat | 1g | 3194.00 Pln | |
| Chemat | 5g | 14771.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1820583-83-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: JYCRXMSJGZWACP-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | JYCRXMSJGZWACP-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)