CAS 1820583-83-2 appears in our catalog under these names: (2S,4S)-1-(tert-Butoxycarbonyl)-2-methylpiperidine-4-carboxylic acid, 98%, (2S,4S)-1-(tert-butoxycarbonyl)-2-methylpiperidine-4-carboxylic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g, 500mg.
(2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1820583-83-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: JYCRXMSJGZWACP-IUCAKERBSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2S,4S)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | JYCRXMSJGZWACP-IUCAKERBSA-N |
| SMILES | C[C@H]1C[C@H](CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)