CAS 193085-98-2 appears in our catalog under these names: 1-Boc-2-methylpiperidine-4-carboxylic Acid, 98%, 98%, N-Boc-2-Methyl-1,4-piperidinedicarboxylic Acid, 1–Boc–2–methylpiperidine–4–carboxylic Acid, 1-(tert-Butoxycarbonyl)-2-methylpiperidine-4-carboxylic acid, 96%, 1-(TERT-BUTOXYCARBONYL)-2-METHYLPIPERIDINE-4-CARBOXYLIC ACID, 98%. Offered by: Chemat, TRC, GLPBio, Biosynth, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 193085-98-2) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: JYCRXMSJGZWACP-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | JYCRXMSJGZWACP-UHFFFAOYSA-N |
| SMILES | CC1CC(CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)