CAS 1250959-07-9 appears in our catalog under these names: cis-(±)-N-Boc-2-Methyl-1,4-piperidinedicarboxylic Acid, rac-(2R,4R)-1-((tert-Butoxy)carbonyl)-2-methylpiperidine-4-carboxylic acid. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
(2R,4R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1250959-07-9) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: (2R,4R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: JYCRXMSJGZWACP-RKDXNWHRSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | (2R,4R)-2-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | JYCRXMSJGZWACP-RKDXNWHRSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)