(2S,5R)-1-Boc-2,5-dimethylpiperazine hydrochloride, 95%
cas: 1374975-96-8 — see every product listed under this CAS number, including other names
(2S,5R)-1-Boc-2,5-dimethylpiperazine hydrochloride, 95% (CAS 1374975-96-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F212021-100MG |
| cas | 1374975-96-8 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 216.61 Pln | |
| Fluorochem | 250mg | 237.43 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 5g | 1304.77 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 253.56 Pln | |
| Ambeed | 1g | 442.69 Pln | |
| Ambeed | 5g | 1099.06 Pln | |
| Ambeed | 10g | 2117.00 Pln | |
| Ambeed | 25g | 4664.62 Pln | |
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 779.60 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride (CAS 1374975-96-8) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride. InChIKey: TWALJKZSNHQOBH-RJUBDTSPSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | TWALJKZSNHQOBH-RJUBDTSPSA-N |
| SMILES | C[C@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)C.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2S,5R)-1-Boc-2,5-dimethylpiperazine hydrochloride, (2S,5R)-tert-Butyl 2,5-dimethylpiperazine-1-carboxylate hydrochloride, tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride, tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate hydrochloride, (2S,5R)-1-Boc-2,5-dimethylpiperazinehydrochloride, (2s,5r)-1-n-boc-2,5-dimethylpiperazine hydrochloride, TWALJKZSNHQOBH-RJUBDTSPSA-N, (2S,5R)-2,5-dimethyl-piperazine-1-carboxylic acid tert-butyl ester HCl, tert-Butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate--hydrogen chloride (1/1)