CAS 1374975-96-8 appears in our catalog under these names: (2S,5R)–1–Boc–2,5–dimethylpiperazine hydrochloride, (2S,5R)-1-Boc-2,5-dimethylpiperazine hydrochloride, 95%, 95%, (2S,5R)-1-Boc-2,5-dimethylpiperazine hydrochloride, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride (CAS 1374975-96-8) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride. InChIKey: TWALJKZSNHQOBH-RJUBDTSPSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl (2S,5R)-2,5-dimethylpiperazine-1-carboxylate;hydrochloride |
| InChIKey | TWALJKZSNHQOBH-RJUBDTSPSA-N |
| SMILES | C[C@H]1CN[C@@H](CN1C(=O)OC(C)(C)C)C.Cl |
Computed by PubChem (NCBI)