cas: 745031-35-0 — see every product listed under this CAS number, including other names
(2S,5S)-1-Benzyl-2,5-dimethylpiperazine, 95%, 95% (CAS 745031-35-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ATR-250mg |
| cas | 745031-35-0 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 957.20 Pln | |
| Chemat | 1g | 2474.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride (CAS 745031-35-0) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: (2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride. InChIKey: NNOPREOUOQQPDC-AQEKLAMFSA-N.
| Molecular formula | C13H22Cl2N2 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride |
| InChIKey | NNOPREOUOQQPDC-AQEKLAMFSA-N |
| SMILES | C[C@H]1CN[C@H](CN1CC2=CC=CC=C2)C.Cl.Cl |
Computed by PubChem (NCBI)