CAS 2414476-37-0 is the registry number for rel-(3R,4S)-1-Benzyl-3-methylpiperidin-4-amine dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3S,4R)-1-benzyl-3-methylpiperidin-4-amine;dihydrochloride (CAS 2414476-37-0) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: (3S,4R)-1-benzyl-3-methylpiperidin-4-amine;dihydrochloride. InChIKey: OPZZZCZWHJKIAC-VZCPBZATSA-N.
| Molecular formula | C13H22Cl2N2 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-3-methylpiperidin-4-amine;dihydrochloride |
| InChIKey | OPZZZCZWHJKIAC-VZCPBZATSA-N |
| SMILES | C[C@H]1CN(CC[C@H]1N)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)