CAS 1235058-59-9 appears in our catalog under these names: (R)-1-Benzyl-3-dimethylaminopyrrolidine dihydrochloride, 97%, (R)–1–Benzyl–3–dimethylaminopyrrolidine Dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 25g.
(3R)-1-benzyl-N,N-dimethylpyrrolidin-3-amine;dihydrochloride (CAS 1235058-59-9) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: (3R)-1-benzyl-N,N-dimethylpyrrolidin-3-amine;dihydrochloride. InChIKey: QFYKJDHVUCCZDE-FFXKMJQXSA-N.
| Molecular formula | C13H22Cl2N2 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (3R)-1-benzyl-N,N-dimethylpyrrolidin-3-amine;dihydrochloride |
| InChIKey | QFYKJDHVUCCZDE-FFXKMJQXSA-N |
| SMILES | CN(C)[C@@H]1CCN(C1)CC2=CC=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)