CAS 198896-00-3 is the registry number for (2R,5S)-1-Benzyl-2,5-dimethylpiperazine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2R,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride (CAS 198896-00-3) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: (2R,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride. InChIKey: NNOPREOUOQQPDC-UVDYRLMLSA-N.
| Molecular formula | C13H22Cl2N2 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (2R,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride |
| InChIKey | NNOPREOUOQQPDC-UVDYRLMLSA-N |
| SMILES | C[C@@H]1CN[C@H](CN1CC2=CC=CC=C2)C.Cl.Cl |
Computed by PubChem (NCBI)