CAS 745031-35-0 appears in our catalog under these names: 1-Benzyl-2(s),5(s)-dimethyl-piperazine, 95%, (2S,5S)–1–benzyl–2,5–dimethyl–piperazine dihydrochloride, (2S,5S)-1-Benzyl-2,5-dimethylpiperazine, 95%, 95%, (2S,5S)-1-BENZYL-2,5-DIMETHYLPIPERAZINE DIHYDROCHLORIDE, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
(2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride (CAS 745031-35-0) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: (2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride. InChIKey: NNOPREOUOQQPDC-AQEKLAMFSA-N.
| Molecular formula | C13H22Cl2N2 |
|---|---|
| Molecular weight | 277.23 g/mol |
| IUPAC name | (2S,5S)-1-benzyl-2,5-dimethylpiperazine;dihydrochloride |
| InChIKey | NNOPREOUOQQPDC-AQEKLAMFSA-N |
| SMILES | C[C@H]1CN[C@H](CN1CC2=CC=CC=C2)C.Cl.Cl |
Computed by PubChem (NCBI)