Products 1390654-99-5

CAS 1390654-99-5 is the registry number for [2-(1-Benzyl-3-pyrrolidinyl)ethyl]amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(1-benzylpyrrolidin-3-yl)ethanamine;dihydrochloride (CAS 1390654-99-5) is a chemical compound with the molecular formula C13H22Cl2N2 and a molecular weight of 277.23 g/mol. IUPAC name: 2-(1-benzylpyrrolidin-3-yl)ethanamine;dihydrochloride. InChIKey: JCKBGRLEILSJPB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H22Cl2N2
Molecular weight277.23 g/mol
IUPAC name2-(1-benzylpyrrolidin-3-yl)ethanamine;dihydrochloride
InChIKeyJCKBGRLEILSJPB-UHFFFAOYSA-N
SMILESC1CN(CC1CCN)CC2=CC=CC=C2.Cl.Cl

Computed by PubChem (NCBI)