CAS 279261-89-1 appears in our catalog under these names: 3,4-Dihydro-2H-1,5-benzodioxepin-7-ylboronic acid, 90%, May contain varying amounts of anhydride , (3,4-Dihydro-2H-1,5-benzodioxepin-7-yl)boronic acid, 98%, 98%, (3,4-Dihydro-2H-benzo[b][1,4]dioxepin-7-yl)boronic acid, 98%. Offered by: Thermo Scientific, Chemat, Fluorochem, Ambeed. Available pack sizes: 250MG, 1g, 5g, 25g.
3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid (CAS 279261-89-1) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid. InChIKey: CSNCBPVLUIFJOS-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-7-ylboronic acid |
| InChIKey | CSNCBPVLUIFJOS-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)OCCCO2)(O)O |
Computed by PubChem (NCBI)