Products 717107-32-9

CAS 717107-32-9 is the registry number for 2-(2-Carboxyethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(2-boronophenyl)propanoic acid (CAS 717107-32-9) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: 3-(2-boronophenyl)propanoic acid. InChIKey: HKXURCOFHUFAMP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BO4
Molecular weight193.99 g/mol
IUPAC name3-(2-boronophenyl)propanoic acid
InChIKeyHKXURCOFHUFAMP-UHFFFAOYSA-N
SMILESB(C1=CC=CC=C1CCC(=O)O)(O)O

Computed by PubChem (NCBI)