Products 1215281-20-1
CAS 1215281-20-1 appears in our catalog under these names: 5-Acetyl-2-methoxyphenylboronic acid, 98%, (5-Acetyl-2-methoxyphenyl)boronic acid 97%, 5-Acetyl-2-methoxyphenylboronic acid, 98%, 98%, (5-Acetyl-2-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg, 10g.
(5-acetyl-2-methoxyphenyl)boronic acid (CAS 1215281-20-1) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (5-acetyl-2-methoxyphenyl)boronic acid. InChIKey: SNANZDYRDLEHPZ-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (5-acetyl-2-methoxyphenyl)boronic acid |
| InChIKey | SNANZDYRDLEHPZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)C)OC)(O)O |
Computed by PubChem (NCBI)