CAS 1107064-09-4 appears in our catalog under these names: 3,4-Dihydro-2h-1,5-benzodioxepin-6-ylboronic acid, 95%, (3,4-Dihydro-2H-1,5-benzodioxepin-6-yl)boronic acid, (3,4-Dihydro-2H-benzo[b][1,4]dioxepin-6-yl)boronic acid 95%, 3,4-Dihydro-2h-1,5-benzodioxepin-6-ylboronic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 1g, 10g, 250mg, 0,5g.
3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid (CAS 1107064-09-4) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid. InChIKey: BTDVUENZZYXXFN-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | 3,4-dihydro-2H-1,5-benzodioxepin-6-ylboronic acid |
| InChIKey | BTDVUENZZYXXFN-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=CC=C1)OCCCO2)(O)O |
Computed by PubChem (NCBI)