Products 1072952-04-5
CAS 1072952-04-5 appears in our catalog under these names: 3-Ethoxy-5-formylphenylboronic acid, 98%, (3-Ethoxy-5-formylphenyl)boronic acid, (3-Ethoxy-5-formylphenyl)boronic acid, 95%, 3-Ethoxy-5-formylphenylboronic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, AmBeed, Chemat. Available pack sizes: 250mg, 10g, 5g, 1g, 25g.
(3-ethoxy-5-formylphenyl)boronic acid (CAS 1072952-04-5) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (3-ethoxy-5-formylphenyl)boronic acid. InChIKey: UGWAEFBQEMQRJD-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (3-ethoxy-5-formylphenyl)boronic acid |
| InChIKey | UGWAEFBQEMQRJD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)OCC)C=O)(O)O |
Computed by PubChem (NCBI)