CAS 603122-81-2 appears in our catalog under these names: [4-(methoxycarbonyl)-3-methylphenyl]boronic acid, 96%, (4-(Methoxycarbonyl)-3-Methylphenyl)boronic acid, (4-(Methoxycarbonyl)-3-methylphenyl)boronic acid 98%, (4-(Methoxycarbonyl)-3-methylphenyl)boronic acid, 97%, 97%, (4-(Methoxycarbonyl)-3-methylphenyl)boronic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 10g.
(4-methoxycarbonyl-3-methylphenyl)boronic acid (CAS 603122-81-2) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: (4-methoxycarbonyl-3-methylphenyl)boronic acid. InChIKey: JAVZEYJXDZSLOV-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | (4-methoxycarbonyl-3-methylphenyl)boronic acid |
| InChIKey | JAVZEYJXDZSLOV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OC)C)(O)O |
Computed by PubChem (NCBI)