CAS 179113-89-4 appears in our catalog under these names: (3,5-Difluorophenyl)(phenyl)methanone, 95%, 95%, 3,5-Difluorobenzophenone, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
(3,5-difluorophenyl)-phenylmethanone (CAS 179113-89-4) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (3,5-difluorophenyl)-phenylmethanone. InChIKey: PNRLNUIMFIMZLI-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (3,5-difluorophenyl)-phenylmethanone |
| InChIKey | PNRLNUIMFIMZLI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)