CAS 345-92-6 appears in our catalog under these names: 4,4'-Difluorobenzophenone, 98%, 4,4'-Difluorobenzophenone, >95% (HPLC), 4,4'-Difluorobenzophenone, 4,4'–Difluorobenzophenone, 4,4'-Difluorobenzophenone, 98+% . Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 5g, 100g, 500g, 1kg, 25g, 250g, 100mg, 10g.
Bis(4-fluorophenyl)methanone (CAS 345-92-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: bis(4-fluorophenyl)methanone. InChIKey: LSQARZALBDFYQZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | bis(4-fluorophenyl)methanone |
| InChIKey | LSQARZALBDFYQZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)