CAS 208173-20-0 appears in our catalog under these names: 2,3-Difluorobenzophenone, 95%, (2,3-Difluorophenyl)(phenyl)methanone, 95+%, (2,3-Difluorophenyl)(phenyl)methanone, 95%, 95%, 2,3-Difluorobenzophenone, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g, 50g.
(2,3-difluorophenyl)-phenylmethanone (CAS 208173-20-0) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,3-difluorophenyl)-phenylmethanone. InChIKey: BWQOPMJTQPWHOZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,3-difluorophenyl)-phenylmethanone |
| InChIKey | BWQOPMJTQPWHOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)