CAS 1181359-89-6 is the registry number for 3-(2,5-Difluorophenyl)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(2,5-difluorophenyl)benzaldehyde (CAS 1181359-89-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: 3-(2,5-difluorophenyl)benzaldehyde. InChIKey: GBFITCIWEFRXII-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 3-(2,5-difluorophenyl)benzaldehyde |
| InChIKey | GBFITCIWEFRXII-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=C(C=CC(=C2)F)F)C=O |
Computed by PubChem (NCBI)