CAS 59189-51-4 appears in our catalog under these names: 2,6-Difluorobenzophenone, 95%, (2,6-Difluorophenyl)(phenyl)methanone, 98%, 2,6–Difluorobenzophenone, 2,6-Difluorobenzophenone, ≥98%, ≥98%, 2,6-Difluorobenzophenone, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g.
(2,6-difluorophenyl)-phenylmethanone (CAS 59189-51-4) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,6-difluorophenyl)-phenylmethanone. InChIKey: KTRGJHDNHIPMEY-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,6-difluorophenyl)-phenylmethanone |
| InChIKey | KTRGJHDNHIPMEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)