CAS 2221812-11-7 appears in our catalog under these names: 2,4-Difluoro-[1,1'-biphenyl]-3-carbaldehyde, 95%, 2,6-Difluoro-3-phenylbenzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 10g, 250mg, 5g.
2,6-difluoro-3-phenylbenzaldehyde (CAS 2221812-11-7) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: 2,6-difluoro-3-phenylbenzaldehyde. InChIKey: GXYLQSXHNZYODU-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 2,6-difluoro-3-phenylbenzaldehyde |
| InChIKey | GXYLQSXHNZYODU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=C(C=C2)F)C=O)F |
Computed by PubChem (NCBI)