cas: 187804-79-1 — see every product listed under this CAS number, including other names
(3–Fluoro–4–(trifluoromethoxy)phenyl)boronic acid (CAS 187804-79-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF52390-10g |
| cas | 187804-79-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 1996.51 Pln | |
| GLPBio | 1g | 709.37 Pln | |
| GLPBio | 250mg | 531.51 Pln | |
| GLPBio | 5g | 1402.09 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
[3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 187804-79-1) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VDEVIIGZNWVCOR-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VDEVIIGZNWVCOR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)