cas: 187804-79-1 — see every product listed under this CAS number, including other names
3-Fluoro-4-(trifluoromethoxy)phenylboronic acid, 97%, 97% (CAS 187804-79-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 100mg, 250mg, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GIL-1g |
| cas | 187804-79-1 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 208.40 Pln | |
| Chemat | 10g | 1168.40 Pln | |
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 5g | 635.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
[3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid (CAS 187804-79-1) is a chemical compound with the molecular formula C7H5BF4O3 and a molecular weight of 223.92 g/mol. IUPAC name: [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid. InChIKey: VDEVIIGZNWVCOR-UHFFFAOYSA-N.
| Molecular formula | C7H5BF4O3 |
|---|---|
| Molecular weight | 223.92 g/mol |
| IUPAC name | [3-fluoro-4-(trifluoromethoxy)phenyl]boronic acid |
| InChIKey | VDEVIIGZNWVCOR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)