cas: 870778-98-6 — see every product listed under this CAS number, including other names
(3-((3-(Trifluoromethyl)phenoxy)methyl)phenyl)boronic acid (CAS 870778-98-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F696382-5G |
| cas | 870778-98-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1325.59 Pln | |
| Fluorochem | 10g | 2200.28 Pln |
| delivery time | 3-4 weeks |
|---|
[3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid (CAS 870778-98-6) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid. InChIKey: TVFNNGHGIHZSDV-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid |
| InChIKey | TVFNNGHGIHZSDV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)