CAS 870778-98-6 is the registry number for 3-(3'-(Trifluoromethyl)phenoxymethyl)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid (CAS 870778-98-6) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid. InChIKey: TVFNNGHGIHZSDV-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [3-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid |
| InChIKey | TVFNNGHGIHZSDV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)