CAS 1217501-32-0 appears in our catalog under these names: 4-Benzyloxy-2-trifluoromethylphenylboronic acid, 98%, (4-(Benzyloxy)-2-(trifluoromethyl)phenyl)boronic acid 96%, (4-(Benzyloxy)-2-(trifluoromethyl)phenyl)boronic acid, 96%, 96%, (4-(Benzyloxy)-2-(trifluoromethyl)phenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 100mg, 250mg.
[4-phenylmethoxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 1217501-32-0) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [4-phenylmethoxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: PFRQXVBDZOMJDK-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [4-phenylmethoxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | PFRQXVBDZOMJDK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)