CAS 1245014-05-4 appears in our catalog under these names: [4-(benzyloxy)-3-(trifluoromethyl)phenyl]boronic acid, 98%, (4-(Benzyloxy)-3-(trifluoromethyl)phenyl)boronic acid 95%, (4-(Benzyloxy)-3-(trifluoromethyl)phenyl)boronic acid, 98%, (4-(Benzyloxy)-3-(trifluoromethyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 1g, 250mg, 100mg.
[4-phenylmethoxy-3-(trifluoromethyl)phenyl]boronic acid (CAS 1245014-05-4) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [4-phenylmethoxy-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: WNDRDSTVBFGULJ-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [4-phenylmethoxy-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WNDRDSTVBFGULJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)