CAS 849062-03-9 appears in our catalog under these names: 4-(3'-(Trifluoromethyl)phenoxymethyl)phenylboronic acid, 98%, 4–(3′–(Trifluoromethyl)phenoxymethyl)phenylboronic acid, (4-((3-(Trifluoromethyl)phenoxy)methyl)phenyl)boronic acid 98%, (4-((3-(Trifluoromethyl)phenoxy)methyl)phenyl)boronic acid, 98%, 98%, (4-((3-(Trifluoromethyl)phenoxy)methyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 250mg.
[4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid (CAS 849062-03-9) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid. InChIKey: IOZGRQTUNSRWBS-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [4-[[3-(trifluoromethyl)phenoxy]methyl]phenyl]boronic acid |
| InChIKey | IOZGRQTUNSRWBS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)COC2=CC=CC(=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)