CAS 1334307-13-9 appears in our catalog under these names: (3-([3-(Trifluoromethyl)phenyl]methoxy)phenyl)boronic acid, 95%, (3–((3–(Trifluoromethyl)benzyl)oxy)phenyl)boronic acid, (3-[[3-(Trifluoromethyl)phenyl]methoxy]phenyl)boronic acid, 97%, 97%, (3-((3-(TRIFLUOROMETHYL)BENZYL)OXY)PHENYL)BORONIC ACID, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
[3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid (CAS 1334307-13-9) is a chemical compound with the molecular formula C14H12BF3O3 and a molecular weight of 296.05 g/mol. IUPAC name: [3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid. InChIKey: GFWAXSZKGMQBDW-UHFFFAOYSA-N.
| Molecular formula | C14H12BF3O3 |
|---|---|
| Molecular weight | 296.05 g/mol |
| IUPAC name | [3-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]boronic acid |
| InChIKey | GFWAXSZKGMQBDW-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC(=CC=C2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)