cas: 380430-52-4 — see every product listed under this CAS number, including other names
(3-((Benzyloxy)Carbonyl)Phenyl)Boronic Acid, 98%, 98% (CAS 380430-52-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11480Q-250mg |
| cas | 380430-52-4 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 290.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3-phenylmethoxycarbonylphenyl)boronic acid (CAS 380430-52-4) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (3-phenylmethoxycarbonylphenyl)boronic acid. InChIKey: JJEBLYAGYRLJRG-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (3-phenylmethoxycarbonylphenyl)boronic acid |
| InChIKey | JJEBLYAGYRLJRG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)