CAS 184000-11-1 appears in our catalog under these names: 4–(Benzyloxycarbonyl)benzeneboronic acid (contains varying amounts of Anhydride), 4-(Benzyloxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), 4-Benzyloxycarbonylphenylboronic acid, 97%, 97%, 4-(Benzyloxycarbonyl)phenylboronic acid, 97%, (4-((Benzyloxy)carbonyl)phenyl)boronic acid, 97%. Offered by: GLPBio, TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 500mg, 5g, 250mg, 10g, 25g.
(4-phenylmethoxycarbonylphenyl)boronic acid (CAS 184000-11-1) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (4-phenylmethoxycarbonylphenyl)boronic acid. InChIKey: UXSDJFGNRVVDFM-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (4-phenylmethoxycarbonylphenyl)boronic acid |
| InChIKey | UXSDJFGNRVVDFM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)