CAS 1187188-60-8 appears in our catalog under these names: Crisaborole Impurity 6, Crisaborole Impurity 59, Crisaborole Impurity 37, 5-(4-(Hydroxylmethyl)phenoxy)benzo(c)(1,2)oxaborol-1-(3H)-ol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
[4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanol (CAS 1187188-60-8) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: [4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanol. InChIKey: ZYSMVTJFVYIMEE-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | [4-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]phenyl]methanol |
| InChIKey | ZYSMVTJFVYIMEE-UHFFFAOYSA-N |
| SMILES | B1(C2=C(CO1)C=C(C=C2)OC3=CC=C(C=C3)CO)O |
Computed by PubChem (NCBI)