Products 139962-97-3
CAS 139962-97-3 appears in our catalog under these names: 4-Benzyloxy-2-formylphenylboronic Acid (contains varying amounts of Anhydride), (4-(Benzyloxy)-2-Formylphenyl)Boronic Acid, 95%, 95%, (4-(Benzyloxy)-2-formylphenyl)boronic acid, 98%, (4-(Benzyloxy)-2-formylphenyl)boronic acid, 95%. Offered by: TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 200mg, 1g, 250mg, 5g, 25g, 10g.
(2-formyl-4-phenylmethoxyphenyl)boronic acid (CAS 139962-97-3) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (2-formyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: XRARNEIDTRHXKN-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (2-formyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | XRARNEIDTRHXKN-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC2=CC=CC=C2)C=O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Benzyloxy-2-formylphenylboronic Acid (contains varying amounts of Anhydride), 4-benzyloxy-2-formylphenylboronic acid, (4-(Benzyloxy)-2-formylphenyl)boronic acid, 4-benzyloxy-2-formylphenyl boronic acid, (2-formyl-4-phenylmethoxyphenyl)boronic acid, (4-benzyloxy-2-formyl-phenyl)boronic acid, [4-(benzyloxy)-2-formylphenyl]boronic acid, (4-benzyloxy-2-formyl) phenyl boronic acid, Boronic acid, [2-formyl-4-(phenylmethoxy)phenyl]-, 4-(benzyloxy)-2-formylphenylboronic acid