(3-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 97%
cas: 643094-11-5 — see every product listed under this CAS number, including other names
(3-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 97% (CAS 643094-11-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A192567-100mg |
| cas | 643094-11-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 136.75 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 676.31 Pln | |
| Ambeed | 5g | 3107.12 Pln | |
| Ambeed | 25g | 10699.94 Pln | |
| BLDpharm | 100mg | 136.64 Pln | |
| BLDpharm | 250mg | 236.61 Pln | |
| BLDpharm | 1g | 725.32 Pln | |
| BLDpharm | 5g | 3346.62 Pln | |
| BLDpharm | 25g | 11532.63 Pln | |
| Fluorochem | 100mg | 122.89 Pln | |
| Fluorochem | 250mg | 216.61 Pln | |
| Fluorochem | 1g | 570.65 Pln | |
| Fluorochem | 5g | 2512.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[3-(2-methoxy-2-oxoethyl)phenyl]boronic acid (CAS 643094-11-5) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: [3-(2-methoxy-2-oxoethyl)phenyl]boronic acid. InChIKey: PBNUXNCUNUMZFL-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | [3-(2-methoxy-2-oxoethyl)phenyl]boronic acid |
| InChIKey | PBNUXNCUNUMZFL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)CC(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(2-Methoxy-2-oxoethyl)phenylboronic acid, (3-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, [3-(2-methoxy-2-oxoethyl)phenyl]boronic acid, Benzeneacetic acid, 3-borono-, 1-methyl ester, PBNUXNCUNUMZFL-UHFFFAOYSA-N, (3-(2-Methoxy-2-oxoethyl)phenyl)boronicacid, 3-((methoxycarbonyl)methyl)phenylboronic acid, [3-(2-methoxy-2-oxo-ethyl)phenyl]boronic acid