cas: 1228829-23-9 — see every product listed under this CAS number, including other names
(3-(Benzyloxy)-4-formylphenyl)boronic acid, 96% (CAS 1228829-23-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F695724-250MG |
| cas | 1228829-23-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 2.5g | 518.59 Pln | |
| Fluorochem | 5g | 846.59 Pln |
| purity | 96% |
|---|---|
| delivery time | 3-4 weeks |
(4-formyl-3-phenylmethoxyphenyl)boronic acid (CAS 1228829-23-9) is a chemical compound with the molecular formula C14H13BO4 and a molecular weight of 256.06 g/mol. IUPAC name: (4-formyl-3-phenylmethoxyphenyl)boronic acid. InChIKey: APMKPYLKWZTWKX-UHFFFAOYSA-N.
| Molecular formula | C14H13BO4 |
|---|---|
| Molecular weight | 256.06 g/mol |
| IUPAC name | (4-formyl-3-phenylmethoxyphenyl)boronic acid |
| InChIKey | APMKPYLKWZTWKX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)