cas: 1236191-14-2 — see every product listed under this CAS number, including other names
(3-(Neopentyloxy)phenyl)boronic acid 96% (CAS 1236191-14-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A358717-250mg |
| cas | 1236191-14-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1744.31 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A358717 |
[3-(2,2-dimethylpropoxy)phenyl]boronic acid (CAS 1236191-14-2) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: [3-(2,2-dimethylpropoxy)phenyl]boronic acid. InChIKey: RMCIUKKXWNLWSX-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | [3-(2,2-dimethylpropoxy)phenyl]boronic acid |
| InChIKey | RMCIUKKXWNLWSX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)