Products 849062-16-4

CAS 849062-16-4 appears in our catalog under these names: 3,5-Dimethyl-4-isopropoxyphenylboronic acid, 98%, (4-Isopropoxy-3,5-dimethylphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

(3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid (CAS 849062-16-4) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OESNXDCMAFEMMC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H17BO3
Molecular weight208.06 g/mol
IUPAC name(3,5-dimethyl-4-propan-2-yloxyphenyl)boronic acid
InChIKeyOESNXDCMAFEMMC-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)C)OC(C)C)C)(O)O

Computed by PubChem (NCBI)