CAS 864776-02-3 appears in our catalog under these names: 2-Methylfuran-3-boronic acid, pinacol ester, 98%, 4,4,5,5-Tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane, 98%, 4,4,5,5-Tetramethyl-2-(2-methyl-3-furyl)-1,3,2-dioxaborolane, 90%, 4,4,5,5-Tetramethyl-2-(2-methyl-3-furyl)-1,3,2-dioxaborolane, 90% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Acros), Thermo Scientific. Available pack sizes: 5g, 1g, 250mg, 25g.
4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane (CAS 864776-02-3) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane. InChIKey: JMLBPHNESOKSEV-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-(2-methylfuran-3-yl)-1,3,2-dioxaborolane |
| InChIKey | JMLBPHNESOKSEV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(OC=C2)C |
Computed by PubChem (NCBI)