CAS 938443-38-0 is the registry number for 4-(Neopentyloxy)phenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[4-(2,2-dimethylpropoxy)phenyl]boronic acid (CAS 938443-38-0) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: [4-(2,2-dimethylpropoxy)phenyl]boronic acid. InChIKey: BQLAQNYVAYGYQT-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | [4-(2,2-dimethylpropoxy)phenyl]boronic acid |
| InChIKey | BQLAQNYVAYGYQT-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)