CAS 1236191-14-2 appears in our catalog under these names: 3-(Neopentyloxy)phenylboronic acid, 96%, 3-(Neopentyloxy)phenylboronic acid, 96%, 96%, (3-(Neopentyloxy)phenyl)boronic acid, 96%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 10g, 1g, 250mg.
[3-(2,2-dimethylpropoxy)phenyl]boronic acid (CAS 1236191-14-2) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: [3-(2,2-dimethylpropoxy)phenyl]boronic acid. InChIKey: RMCIUKKXWNLWSX-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | [3-(2,2-dimethylpropoxy)phenyl]boronic acid |
| InChIKey | RMCIUKKXWNLWSX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)