Products 196960-96-0
CAS 196960-96-0 appears in our catalog under these names: (3-tert-Butyl-4-methoxyphenyl)boronic acid, 96%, (3-(tert-Butyl)-4-methoxyphenyl)boronic acid 98%, (3-(tert-Butyl)-4-methoxyphenyl)boronic acid, 98%, 98%, (3-tert-Butyl-4-methoxyphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(3-tert-butyl-4-methoxyphenyl)boronic acid (CAS 196960-96-0) is a chemical compound with the molecular formula C11H17BO3 and a molecular weight of 208.06 g/mol. IUPAC name: (3-tert-butyl-4-methoxyphenyl)boronic acid. InChIKey: LKZFCLMTTASCPA-UHFFFAOYSA-N.
| Molecular formula | C11H17BO3 |
|---|---|
| Molecular weight | 208.06 g/mol |
| IUPAC name | (3-tert-butyl-4-methoxyphenyl)boronic acid |
| InChIKey | LKZFCLMTTASCPA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-tert-butyl-4-methoxyphenyl)boronic acid, 3-tert-butyl-4-methoxyphenylboronic acid, 3-(t-butyl)-4-methoxyphenylboronic acid, 3-(t-butyl)-4-methoxyphenyl boronic acid, LKZFCLMTTASCPA-UHFFFAOYSA-N, (3-tert-butyl-4-methoxy-phenyl)boronic acid, Boronic acid, B-[3-(1,1-dimethylethyl)-4-methoxyphenyl]-