CAS 2223040-24-0 is the registry number for 3–Cyanofuran–2–boronic acid pinacol ester. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile (CAS 2223040-24-0) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile. InChIKey: DPOWFEYYNNPWPD-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile |
| InChIKey | DPOWFEYYNNPWPD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CO2)C#N |
Computed by PubChem (NCBI)