CAS 2223039-44-7 is the registry number for 5–(4,4,5,5–Tetramethyl–1,3,2–dioxaborolan–2–yl)furan–3–carbonitrile. Offered by: GLPBio. Available pack sizes: 250mg, 50mg.
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile (CAS 2223039-44-7) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile. InChIKey: CLHLFCSQALEXAD-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)furan-3-carbonitrile |
| InChIKey | CLHLFCSQALEXAD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CO2)C#N |
Computed by PubChem (NCBI)