CAS 876918-32-0 appears in our catalog under these names: (3-Cyano-4-isobutoxyphenyl)boronic acid, 95%, BOronic acid, B-(3-cyano-4-(2-methylpropoxy)phenyl)-, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[3-cyano-4-(2-methylpropoxy)phenyl]boronic acid (CAS 876918-32-0) is a chemical compound with the molecular formula C11H14BNO3 and a molecular weight of 219.05 g/mol. IUPAC name: [3-cyano-4-(2-methylpropoxy)phenyl]boronic acid. InChIKey: ZRLYHURWZGCNKP-UHFFFAOYSA-N.
| Molecular formula | C11H14BNO3 |
|---|---|
| Molecular weight | 219.05 g/mol |
| IUPAC name | [3-cyano-4-(2-methylpropoxy)phenyl]boronic acid |
| InChIKey | ZRLYHURWZGCNKP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC(C)C)C#N)(O)O |
Computed by PubChem (NCBI)