cas: 96219-87-3 — see every product listed under this CAS number, including other names
(3-Amino-1H-pyrazol-4-yl)(thiophen-2-yl)methanone 95% (CAS 96219-87-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A222869-100mg |
| cas | 96219-87-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 170.12 Pln | |
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1633.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A222869 |
(5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone (CAS 96219-87-3) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: (5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone. InChIKey: DKSHGSCMEXOBRE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | (5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone |
| InChIKey | DKSHGSCMEXOBRE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=C(NN=C2)N |
Computed by PubChem (NCBI)