CAS 96219-87-3 appears in our catalog under these names: (3-Aminopyrazol-4-yl)(2-thienyl)methanone, 95%, (3–Amino–1H–pyrazol–4–yl)(thiophen–2–yl)methanone, (3-Amino-1H-pyrazol-4-yl)(thiophen-2-yl)methanone, 95%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
(5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone (CAS 96219-87-3) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: (5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone. InChIKey: DKSHGSCMEXOBRE-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | (5-amino-1H-pyrazol-4-yl)-thiophen-2-ylmethanone |
| InChIKey | DKSHGSCMEXOBRE-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C2=C(NN=C2)N |
Computed by PubChem (NCBI)