CAS 111962-90-4 appears in our catalog under these names: 2-Aminobenzothiazole-6-carboxamide, 98%, 2-Amino-benzothiazole-6-carboxylic acid amide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg.
2-amino-1,3-benzothiazole-6-carboxamide (CAS 111962-90-4) is a chemical compound with the molecular formula C8H7N3OS and a molecular weight of 193.23 g/mol. IUPAC name: 2-amino-1,3-benzothiazole-6-carboxamide. InChIKey: HPRLVAQRFQEQPF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3OS |
|---|---|
| Molecular weight | 193.23 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazole-6-carboxamide |
| InChIKey | HPRLVAQRFQEQPF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)N)SC(=N2)N |
Computed by PubChem (NCBI)